CymitQuimica logo

CAS 123024-53-3

:

4-Chloro-2-hydrazinyl-6-methylpyrimidine

Description:
4-Chloro-2-hydrazinyl-6-methylpyrimidine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a chloro group at the 4-position and a hydrazinyl group at the 2-position contributes to its reactivity and potential applications in medicinal chemistry. The methyl group at the 6-position enhances its lipophilicity, which may influence its biological activity. This compound is often studied for its potential as a pharmaceutical intermediate or as a building block in the synthesis of more complex molecules. Its hydrazinyl functional group can participate in various chemical reactions, including condensation and coupling reactions, making it versatile in organic synthesis. Additionally, the presence of halogen and nitrogen functionalities may impart specific properties such as increased solubility in polar solvents and potential interactions with biological targets. As with many nitrogen-containing heterocycles, it may exhibit interesting pharmacological properties, warranting further investigation in drug development contexts.
Formula:C5H7ClN4
InChI:InChI=1S/C5H7ClN4/c1-3-2-4(6)9-5(8-3)10-7/h2H,7H2,1H3,(H,8,9,10)
InChI key:InChIKey=IIYWGEDBWWDWFH-UHFFFAOYSA-N
SMILES:N(N)=C1NC(C)=CC(Cl)=N1
Synonyms:
  • 4-Chloro-2-hydrazinyl-6-methylpyrimidine
  • (4-Chloro-6-methyl-pyrimidin-2-yl)-hydrazine
  • Pyrimidine, 4-chloro-2-hydrazinyl-6-methyl-
  • 2(1H)-Pyrimidinone, 4-chloro-6-methyl-, hydrazone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.