CymitQuimica logo

CAS 1231930-25-8

:

1-[(6-bromo-3-pyridinyl)methyl]-4-ethyl-Piperazine

Description:
1-[(6-bromo-3-pyridinyl)methyl]-4-ethylpiperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a 6-bromo-3-pyridinyl group indicates that the compound has a bromine atom and a pyridine ring, contributing to its potential biological activity and lipophilicity. The ethyl group at the 4-position of the piperazine ring enhances its steric properties and may influence its interaction with biological targets. This compound is of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that may confer specific pharmacological properties. Its molecular structure suggests potential applications in areas such as neuropharmacology or as a scaffold for drug design. As with many piperazine derivatives, it may exhibit various activities, including receptor modulation or enzyme inhibition, depending on its specific interactions within biological systems. Safety and handling precautions should be observed, as with all chemical substances, particularly those with halogen substituents.
Formula:C12H18BrN3
InChI:InChI=1S/C12H18BrN3/c1-2-15-5-7-16(8-6-15)10-11-3-4-12(13)14-9-11/h3-4,9H,2,5-8,10H2,1H3
InChI key:DMNPLEDMMNWHTL-UHFFFAOYSA-N
SMILES:CCN1CCN(CC1)CC2=CN=C(C=C2)Br
Synonyms:
  • 1-((6-Bromopyridin-3-Yl)Methyl)-4-Ethylpiperazine
Found 7 products.