CAS 1233855-46-3
:N-Cyclohexyl-N-methyl-4-(1-oxido-3-pyridinyl)-1H-imidazole-1-carboxamide
Description:
N-Cyclohexyl-N-methyl-4-(1-oxido-3-pyridinyl)-1H-imidazole-1-carboxamide is a chemical compound characterized by its complex structure, which includes an imidazole ring, a pyridine moiety, and a cyclohexyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the imidazole and pyridine rings suggests that it may interact with biological targets, possibly influencing enzyme activity or receptor binding. The oxido group indicates the presence of an oxygen atom that may participate in hydrogen bonding, enhancing its interaction with biological systems. Additionally, the cyclohexyl and methyl substituents can influence the compound's lipophilicity and overall pharmacokinetic profile. Overall, this compound's unique structural features contribute to its potential applications in medicinal chemistry, particularly in the development of therapeutic agents. However, specific data regarding its toxicity, stability, and detailed biological activity would require further investigation.
Formula:C16H20N4O2
InChI:InChI=1S/C16H20N4O2/c1-18(14-7-3-2-4-8-14)16(21)19-11-15(17-12-19)13-6-5-9-20(22)10-13/h5-6,9-12,14H,2-4,7-8H2,1H3
InChI key:InChIKey=DOWVMJFBDGWVML-UHFFFAOYSA-N
SMILES:C(N(C)C1CCCCC1)(=O)N2C=C(N=C2)C3=CN(=O)=CC=C3
Synonyms:- N-Cyclohexyl-N-methyl-4-(1-oxido-3-pyridinyl)-1H-imidazole-1-carboxamide
- 1H-Imidazole-1-carboxamide, N-cyclohexyl-N-methyl-4-(1-oxido-3-pyridinyl)-
- BIA10-2474
- BIA10-2474; BIA-10-2474
- CS-2451
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1H-Imidazole-1-carboxamide, N-cyclohexyl-N-methyl-4-(1-oxido-3-pyridinyl)-
CAS:Formula:C16H20N4O2Purity:98%Color and Shape:SolidMolecular weight:300.3556BIA 10-2474
CAS:BIA 10-2474 is a long-acting reversible inhibitor of FAAH that increases levels of the neurotransmitter anandamide in the nervous system.Formula:C16H20N4O2Purity:99.27%Color and Shape:SolidMolecular weight:300.36BIA 10-2474
CAS:BIA 10-2474 is an investigational pharmaceutical compound that functions as a fatty acid amide hydrolase (FAAH) inhibitor. This compound is derived from synthetic sources and works by inhibiting the FAAH enzyme, which is responsible for the degradation of endocannabinoids such as anandamide in the central nervous system. By inhibiting FAAH, BIA 10-2474 increases the levels of endocannabinoids, potentially impacting pain, mood, and neuroinflammation pathways.Formula:C16H20N4O2Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:300.36 g/molN-Cyclohexyl-N-methyl-4-(1-oxido-3-pyridinyl)-1H-imidazole-1-carboxamide
CAS:Controlled ProductFormula:C16H20N4O2Color and Shape:NeatMolecular weight:300.356N-Cyclohexyl-N-methyl-4-(1-oxido-3-pyridinyl)-1H-imidazole-1-carboxamide-d3
CAS:Controlled ProductFormula:C16D3H17N4O2Color and Shape:NeatMolecular weight:303.374




