CymitQuimica logo

CAS 1233855-46-3

:

N-Cyclohexyl-N-methyl-4-(1-oxido-3-pyridinyl)-1H-imidazole-1-carboxamide

Description:
N-Cyclohexyl-N-methyl-4-(1-oxido-3-pyridinyl)-1H-imidazole-1-carboxamide is a chemical compound characterized by its complex structure, which includes an imidazole ring, a pyridine moiety, and a cyclohexyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the imidazole and pyridine rings suggests that it may interact with biological targets, possibly influencing enzyme activity or receptor binding. The oxido group indicates the presence of an oxygen atom that may participate in hydrogen bonding, enhancing its interaction with biological systems. Additionally, the cyclohexyl and methyl substituents can influence the compound's lipophilicity and overall pharmacokinetic profile. Overall, this compound's unique structural features contribute to its potential applications in medicinal chemistry, particularly in the development of therapeutic agents. However, specific data regarding its toxicity, stability, and detailed biological activity would require further investigation.
Formula:C16H20N4O2
InChI:InChI=1S/C16H20N4O2/c1-18(14-7-3-2-4-8-14)16(21)19-11-15(17-12-19)13-6-5-9-20(22)10-13/h5-6,9-12,14H,2-4,7-8H2,1H3
InChI key:InChIKey=DOWVMJFBDGWVML-UHFFFAOYSA-N
SMILES:C(N(C)C1CCCCC1)(=O)N2C=C(N=C2)C3=CN(=O)=CC=C3
Synonyms:
  • N-Cyclohexyl-N-methyl-4-(1-oxido-3-pyridinyl)-1H-imidazole-1-carboxamide
  • 1H-Imidazole-1-carboxamide, N-cyclohexyl-N-methyl-4-(1-oxido-3-pyridinyl)-
  • BIA10-2474
  • BIA10-2474; BIA-10-2474
  • CS-2451
Found 7 products.