CymitQuimica logo

CAS 1233951-78-4

:

1,1-Dimethylethyl 4-[[(phenylamino)carbonyl]amino]-1-piperidinecarboxylate

Description:
1,1-Dimethylethyl 4-[[(phenylamino)carbonyl]amino]-1-piperidinecarboxylate, identified by its CAS number 1233951-78-4, is a chemical compound that features a piperidine ring, which is a six-membered nitrogen-containing heterocycle. This compound is characterized by the presence of a dimethyl group attached to a carbon atom, contributing to its steric bulk and potentially influencing its reactivity and interactions. The phenylamino group indicates the presence of an aromatic amine, which can participate in various chemical reactions, including nucleophilic substitutions. The carbonyl functionality suggests that it may exhibit properties typical of amides or esters, such as potential hydrogen bonding and reactivity towards nucleophiles. The overall structure implies that this compound may have applications in medicinal chemistry, possibly as a pharmaceutical agent, due to its complex architecture that could interact with biological targets. Its solubility, stability, and specific reactivity would depend on the surrounding conditions and the presence of other functional groups in the environment.
Formula:C17H25N3O3
InChI:InChI=1S/C17H25N3O3/c1-17(2,3)23-16(22)20-11-9-14(10-12-20)19-15(21)18-13-7-5-4-6-8-13/h4-8,14H,9-12H2,1-3H3,(H2,18,19,21)
InChI key:InChIKey=HFGCAILZJBRUQK-UHFFFAOYSA-N
SMILES:N(C(NC1=CC=CC=C1)=O)C2CCN(C(OC(C)(C)C)=O)CC2
Synonyms:
  • 1,1-Dimethylethyl 4-[[(phenylamino)carbonyl]amino]-1-piperidinecarboxylate
  • 1-Piperidinecarboxylic acid, 4-[[(phenylamino)carbonyl]amino]-, 1,1-dimethylethyl ester
Found 1 products.