CymitQuimica logo

CAS 1233952-06-1

:

1,1-Dimethylethyl 4-[[(5-nitro-2-pyridinyl)amino]methyl]-1-piperidinecarboxylate

Description:
1,1-Dimethylethyl 4-[[(5-nitro-2-pyridinyl)amino]methyl]-1-piperidinecarboxylate, identified by its CAS number 1233952-06-1, is a chemical compound that features a complex structure incorporating a piperidine ring, a nitro-substituted pyridine moiety, and a tert-butyl group. This compound is characterized by its potential biological activity, often explored in medicinal chemistry for its pharmacological properties. The presence of the nitro group may influence its reactivity and solubility, while the piperidine ring contributes to its basicity and potential interactions with biological targets. The tert-butyl group enhances lipophilicity, which can affect the compound's absorption and distribution in biological systems. Additionally, the compound may exhibit specific stereochemical configurations that can impact its efficacy and safety profile. Overall, this substance represents a class of compounds that may have applications in drug development, particularly in targeting specific receptors or enzymes within biological pathways.
Formula:C16H24N4O4
InChI:InChI=1S/C16H24N4O4/c1-16(2,3)24-15(21)19-8-6-12(7-9-19)10-17-14-5-4-13(11-18-14)20(22)23/h4-5,11-12H,6-10H2,1-3H3,(H,17,18)
InChI key:InChIKey=XLFOYXFTQUQBOC-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(N(=O)=O)C=N1)C2CCN(C(OC(C)(C)C)=O)CC2
Synonyms:
  • 1,1-Dimethylethyl 4-[[(5-nitro-2-pyridinyl)amino]methyl]-1-piperidinecarboxylate
  • 1-Piperidinecarboxylic acid, 4-[[(5-nitro-2-pyridinyl)amino]methyl]-, 1,1-dimethylethyl ester
Found 1 products.