CymitQuimica logo

CAS 1233952-69-6

:

1-Piperidinecarboxamide, N-4-piperidinyl-, hydrochloride (1:1)

Description:
1-Piperidinecarboxamide, N-4-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine structure, which includes a six-membered ring containing nitrogen atoms. This compound is typically presented as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical formulations. The presence of the carboxamide functional group contributes to its potential biological activity, as amides often play a crucial role in drug design due to their ability to form hydrogen bonds. The compound may exhibit properties such as moderate to high polarity, influencing its interaction with biological systems. Its specific applications can vary, but it may be investigated for its potential therapeutic effects, particularly in the context of neurological or psychiatric disorders, given the structural similarities to other pharmacologically active piperidine derivatives. Safety and handling precautions are essential, as with any chemical substance, to mitigate risks associated with exposure.
Formula:C11H21N3O·ClH
InChI:InChI=1S/C11H21N3O.ClH/c15-11(14-8-2-1-3-9-14)13-10-4-6-12-7-5-10;/h10,12H,1-9H2,(H,13,15);1H
InChI key:InChIKey=PQPRWIKEGNARAL-UHFFFAOYSA-N
SMILES:C(NC1CCNCC1)(=O)N2CCCCC2.Cl
Synonyms:
  • 1-Piperidinecarboxamide, N-4-piperidinyl-, hydrochloride (1:1)
Found 1 products.