CymitQuimica logo

CAS 1234616-39-7

:

3H-IMidazo[4,5-c]pyridine-7-carboxylic acid

Description:
3H-Imidazo[4,5-c]pyridine-7-carboxylic acid is a heterocyclic organic compound characterized by its imidazole and pyridine ring structures. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The imidazo[4,5-c]pyridine framework is known for its biological activity, making it of interest in medicinal chemistry and drug development. The presence of the carboxylic acid group enhances its solubility in polar solvents and can facilitate interactions with biological targets. Additionally, this compound may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, depending on its specific structural features and substituents. Its molecular structure allows for various synthetic modifications, which can lead to derivatives with enhanced pharmacological properties. Overall, 3H-Imidazo[4,5-c]pyridine-7-carboxylic acid represents a versatile scaffold in the field of organic and medicinal chemistry.
Formula:C7H5N3O2
InChI:InChI=1S/C7H5N3O2/c11-7(12)4-1-8-2-5-6(4)10-3-9-5/h1-3H,(H,9,10)(H,11,12)
InChI key:RMQNAJSTWKWBBU-UHFFFAOYSA-N
SMILES:C1=C(C2=C(C=N1)NC=N2)C(=O)O
Synonyms:
  • 3H-IMidazo[4,5-c]pyridine-7-carboxylic acid
Found 4 products.