CymitQuimica logo

CAS 1234616-81-9

:

methyl 3-{[(tert-butoxy)carbonyl]amino}cyclobutane-1-carboxylate

Description:
Methyl 3-{[(tert-butoxy)carbonyl]amino}cyclobutane-1-carboxylate is a chemical compound characterized by its unique structure, which includes a cyclobutane ring, a carboxylate group, and a tert-butoxycarbonyl (Boc) protecting group. This compound is typically used in organic synthesis, particularly in the preparation of amino acids and peptides, due to the presence of the amino group that can participate in various chemical reactions. The tert-butoxycarbonyl group serves as a protective group for the amine, allowing for selective reactions without affecting the amine functionality. The methyl ester group enhances the compound's solubility and reactivity, making it suitable for further transformations. Additionally, the cyclobutane ring introduces strain, which can influence the compound's reactivity and stability. Overall, this compound is of interest in medicinal chemistry and synthetic organic chemistry for its potential applications in drug development and the synthesis of complex organic molecules.
Formula:C11H19NO4
InChI:InChI=1S/C11H19NO4/c1-11(2,3)16-10(14)12-8-5-7(6-8)9(13)15-4/h7-8H,5-6H2,1-4H3,(H,12,14)
InChI key:LJEVCFPGOOEUKG-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NC1CC(C1)C(=O)OC
Found 3 products.