CymitQuimica logo

CAS 1235036-15-3

:

tert-Butyl 3-bromo-6-chloropicolinate

Description:
Tert-Butyl 3-bromo-6-chloropicolinate is an organic compound characterized by its unique structure, which includes a tert-butyl group, a bromine atom, and a chlorine atom attached to a picolinate backbone. The presence of these halogen substituents can significantly influence the compound's reactivity and physical properties, such as solubility and boiling point. Typically, compounds like this exhibit moderate polarity due to the electronegative halogens, which can also affect their interaction with biological systems, making them of interest in medicinal chemistry. The tert-butyl group contributes to steric hindrance, potentially impacting the compound's ability to participate in certain chemical reactions. Additionally, the picolinate moiety may confer specific biological activities, as derivatives of picolinic acid are known to have various pharmacological effects. Overall, tert-Butyl 3-bromo-6-chloropicolinate is a compound of interest for further research in synthetic chemistry and potential applications in drug development.
Formula:C10H11BrClNO2
InChI:InChI=1S/C10H11BrClNO2/c1-10(2,3)15-9(14)8-6(11)4-5-7(12)13-8/h4-5H,1-3H3
InChI key:JKGXLKXQUDHRLL-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)C1=C(C=CC(=N1)Cl)Br
Synonyms:
  • Tert-Butyl 3-Bromo-6-Chloropyridine-2-Carboxylate
  • 1,?1-?Dimethylethyl Ester 3-?Bromo-?6-?chloro-?2-?Pyridinecarboxylic Acid
  • 2-Pyridinecarboxylic acid, 3-broMo-6-chloro-, 1,1-diMethylethyl ester
  • Tert-butyl 3-bromo-6-chloropicolinate
  • 3-Bromo-6-chloro-pyridine-2-carboxylic acid tert-butyl ester
Found 4 products.