
CAS 123564-61-4
:Limonin glucoside
Description:
Limonin glucoside is a naturally occurring compound primarily found in citrus fruits, particularly in the seeds and pulp. It is a type of limonoid, which are compounds known for their bitter taste and potential health benefits. Limonin glucoside is characterized by its glycosidic structure, which includes a glucose moiety attached to the limonin backbone, enhancing its solubility in water compared to its aglycone form. This compound is recognized for its potential antioxidant properties and may exhibit various biological activities, including anti-inflammatory and anticancer effects. Its bitterness can influence the flavor profile of citrus products, making it a subject of interest in food science and nutrition. Additionally, limonin glucoside's stability under different pH conditions makes it relevant in the formulation of beverages and functional foods. Research continues to explore its pharmacological potential and mechanisms of action, contributing to the understanding of its role in human health and nutrition.
Formula:C32H42O14
InChI:InChI=1S/C32H42O14/c1-28(2)17-9-18(34)30(4)16(31(17)13-42-20(35)10-19(31)45-28)5-7-29(3,32(30)25(46-32)26(39)40)24(14-6-8-41-12-14)44-27-23(38)22(37)21(36)15(11-33)43-27/h6,8,12,15-17,19,21-25,27,33,36-38H,5,7,9-11,13H2,1-4H3,(H,39,40)/t15-,16+,17+,19+,21-,22+,23-,24+,25-,27+,29+,30+,31-,32-/m1/s1
InChI key:InChIKey=FYIKIBQJAJRKQM-WNCNYDOCSA-N
SMILES:C[C@]12[C@]3([C@@]([C@@H](O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)C=5C=COC5)(C)CC[C@@]1([C@]67[C@@](CC2=O)(C(C)(C)O[C@]6(CC(=O)OC7)[H])[H])[H])[C@@H](C(O)=O)O3
Synonyms:- Limonin glucoside
- Limonoic acid, 17-O-β-D-glucopyranosyl-, δ-lactone
- (2aR,3′S,4aS,5R,6S,8aR,8bR,12aS)-6-[(S)-3-Furanyl(β-D-glucopyranosyloxy)methyl]decahydro-2,2,4a,6-tetramethyl-4,11-dioxospiro[9H,11H-naphtho[1′,2′:3,4]furo[3,2-c]pyran-5(2H),2′-oxirane]-3′-carboxylic acid
- Spiro[9H,11H-naphtho[1′,2′:3,4]furo[3,2-c]pyran-5(2H),2′-oxirane]-3′-carboxylic acid, 6-[3-furanyl(β-D-glucopyranosyloxy)methyl]decahydro-2,2,4a,6-tetramethyl-4,11-dioxo-, [2aR-[2aα,4aα,5β(S*),6β(S*),8aα,8bR*,12aα]]-
- Spiro[9H,11H-naphtho[1′,2′:3,4]furo[3,2-c]pyran-5(2H),2′-oxirane]-3′-carboxylic acid, 6-[(S)-3-furanyl(β-D-glucopyranosyloxy)methyl]decahydro-2,2,4a,6-tetramethyl-4,11-dioxo-, (2aR,3′S,4aS,5R,6S,8aR,8bR,12aS)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Limonin 17-β-D-Glucopyranoside
CAS:Limonin 17-β-D-GlucopyranosideFormula:C32H42O14Purity:≥95%Molecular weight:650.67Limonin glucoside
CAS:Limonin glucoside: a citrus compound, blocks HIV/HTLV-1, triggers cancer cell death, kills Aedes larvae.Formula:C32H42O14Color and Shape:SolidMolecular weight:650.674Limonin glucoside
CAS:Limonin glucoside is a bioactive compound, which is primarily derived from citrus fruits, specifically the peels and seeds. It belongs to a class of limonoids, naturally occurring chemicals that are commonly found in the Rutaceae family. The glucoside linkage enhances the solubility and bioavailability of limonin, ensuring effective utilization in biological systems.Formula:C32H42O14Purity:Min. 95%Molecular weight:650.7 g/mol




