CymitQuimica logo

CAS 1235865-75-4

:

Methyl 2-[(1H-pyrrolo[2,3-b]pyridin-5-yl)oxy]-4-fluorobenzoate

Description:
Methyl 2-[(1H-pyrrolo[2,3-b]pyridin-5-yl)oxy]-4-fluorobenzoate, identified by its CAS number 1235865-75-4, is a chemical compound characterized by its complex structure that includes a methyl ester functional group, a fluorobenzene moiety, and a pyrrolopyridine unit. This compound is typically classified as an organic molecule and may exhibit properties such as moderate solubility in organic solvents, potential bioactivity, and specific reactivity due to the presence of the fluorine atom and the ether linkage. The pyrrolopyridine structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with such frameworks often display interesting biological activities. Additionally, the presence of the fluorine atom can enhance metabolic stability and lipophilicity, making it a valuable feature in drug design. Overall, this compound's unique structural characteristics may contribute to its utility in various chemical and biological applications.
Formula:C15H11FN2O3
InChI:InChI=1S/C15H11FN2O3/c1-20-15(19)12-3-2-10(16)7-13(12)21-11-6-9-4-5-17-14(9)18-8-11/h2-8H,1H3,(H,17,18)
InChI key:WOXIJNIAUMZYEL-UHFFFAOYSA-N
SMILES:COC(=O)C1=C(C=C(C=C1)F)OC2=CN=C3C(=C2)C=CN3
Synonyms:
  • Methyl 2-[(1H-pyrrolo[2,3-b]  pyridin-5-yl)oxy]-4-fluoro  benzoate
Found 7 products.