CymitQuimica logo

CAS 1236699-92-5

:

Pimasertib

Description:
Pimasertib, with the CAS number 1236699-92-5, is a small molecule inhibitor that primarily targets the mitogen-activated protein kinase (MAPK) pathway, specifically the MEK1 and MEK2 enzymes. It is classified as a selective MEK inhibitor and has been investigated for its potential therapeutic applications in various cancers, particularly those with mutations in the RAS or RAF genes. Pimasertib exhibits characteristics such as moderate solubility in organic solvents and a relatively low molecular weight, which facilitates its absorption and distribution in biological systems. The compound has been studied in clinical trials, often in combination with other anticancer agents, to enhance therapeutic efficacy and overcome resistance mechanisms. Its mechanism of action involves the inhibition of downstream signaling pathways that promote cell proliferation and survival, making it a candidate for targeted cancer therapy. As with many investigational drugs, the safety profile and pharmacokinetics of Pimasertib are critical areas of ongoing research to determine its clinical utility.
Formula:C15H15FIN3O3
InChI:InChI=1S/C15H15FIN3O3/c16-12-5-9(17)1-2-13(12)20-14-7-18-4-3-11(14)15(23)19-6-10(22)8-21/h1-5,7,10,20-22H,6,8H2,(H,19,23)/t10-/m0/s1
InChI key:VIUAUNHCRHHYNE-JTQLQIEISA-N
SMILES:C1=CC(=C(C=C1I)F)NC2=C(C=CN=C2)C(=O)NC[C@@H](CO)O
Found 9 products.