CymitQuimica logo

CAS 1237535-76-0

:

tert-butyl 4-fluoropyridin-2-ylcarbamate

Description:
Tert-butyl 4-fluoropyridin-2-ylcarbamate is a chemical compound characterized by its unique structure, which includes a tert-butyl group, a fluorinated pyridine ring, and a carbamate functional group. This compound typically exhibits properties associated with both polar and nonpolar characteristics due to the presence of the tert-butyl group, which enhances its lipophilicity, and the pyridine ring, which can engage in hydrogen bonding and dipole interactions. The fluorine atom in the pyridine ring can influence the compound's reactivity and stability, often enhancing its biological activity. Tert-butyl 4-fluoropyridin-2-ylcarbamate may be utilized in various applications, including medicinal chemistry, where it could serve as a potential pharmaceutical intermediate or active ingredient. Its solubility profile, stability under different conditions, and reactivity with other chemical species would be essential factors to consider in practical applications. As with many organic compounds, safety data and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C10H13FN2O2
InChI:InChI=1S/C10H13FN2O2/c1-10(2,3)15-9(14)13-8-6-7(11)4-5-12-8/h4-6H,1-3H3,(H,12,13,14)
InChI key:VIUIAFNUKMJWFD-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NC1=NC=CC(=C1)F
Found 5 products.