CymitQuimica logo

CAS 123809-60-9

:

D-Mannopyranose, 6-O-(2,3,4,6-tetra-O-acetyl-α-D-mannopyranosyl)-, 1,2,3,4-tetraacetate

Description:
D-Mannopyranose, 6-O-(2,3,4,6-tetra-O-acetyl-α-D-mannopyranosyl)-, 1,2,3,4-tetraacetate, identified by CAS number 123809-60-9, is a complex carbohydrate derivative characterized by its acetylated mannopyranose units. This compound features multiple acetyl groups, which enhance its solubility and stability, making it useful in various biochemical applications. The presence of the tetra-O-acetyl groups indicates that all hydroxyl groups on the mannopyranose are acetylated, which can influence its reactivity and interactions with other molecules. The structure suggests that it may participate in glycosidic bond formation, making it relevant in the study of glycosylation processes. Additionally, the compound's stereochemistry, particularly the α-anomeric configuration, plays a crucial role in its biological activity and recognition by enzymes. Overall, this substance is significant in carbohydrate chemistry and may have applications in drug design, synthesis of glycosides, and as a potential building block in the development of glycoproteins or polysaccharides.
Formula:C28H38O19
InChI:InChI=1S/C28H38O19/c1-11(29)37-9-19-21(39-12(2)30)23(41-14(4)32)25(43-16(6)34)27(46-19)38-10-20-22(40-13(3)31)24(42-15(5)33)26(44-17(7)35)28(47-20)45-18(8)36/h19-28H,9-10H2,1-8H3/t19-,20-,21-,22-,23+,24+,25+,26+,27+,28?/m1/s1
InChI key:InChIKey=GNTLGGDVHFXGLI-RHRLCGFESA-N
SMILES:O(C(C)=O)[C@H]1[C@H](OC(C)=O)[C@@H](CO[C@@H]2[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O2)OC(OC(C)=O)[C@H]1OC(C)=O
Synonyms:
  • D-Mannopyranose, 6-O-(2,3,4,6-tetra-O-acetyl-α-D-mannopyranosyl)-, 1,2,3,4-tetraacetate
  • D-Mannopyranose, 6-O-(2,3,4,6-tetra-O-acetyl-α-D-mannopyranosyl)-, tetraacetate
Found 3 products.