CAS 123843-57-2
:2,6-Difluoro-4-hydroxybenzonitrile
Description:
2,6-Difluoro-4-hydroxybenzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two fluorine atoms and a hydroxyl group at the 2 and 4 positions, respectively, along with a nitrile group (-C≡N) at the para position. This compound typically appears as a solid at room temperature and is known for its potential applications in pharmaceuticals and agrochemicals due to the presence of both the hydroxy and nitrile functional groups, which can participate in various chemical reactions. The fluorine substituents enhance the compound's lipophilicity and may influence its biological activity. Additionally, the presence of the hydroxyl group can contribute to hydrogen bonding, affecting solubility and reactivity. Safety data indicates that, like many fluorinated compounds, it should be handled with care due to potential toxicity and environmental impact. Overall, 2,6-Difluoro-4-hydroxybenzonitrile is a versatile compound with significant relevance in synthetic organic chemistry.
Formula:C7H3F2NO
InChI:InChI=1S/C7H3F2NO/c8-6-1-4(11)2-7(9)5(6)3-10/h1-2,11H
InChI key:InChIKey=KEIYYIGMDPTAPL-UHFFFAOYSA-N
SMILES:C(#N)C1=C(F)C=C(O)C=C1F
Synonyms:- 2,6-Difluoro-4-Hydroxy Benzonitrile
- 2,6-Difluoro-4-hydroxybenzonitrile
- 3,5-Difluoro-4-(Trifluoromethyl)Aniline
- 3,5-Difluoro-4-Cyanophenol
- Benzonitrile, 2,6-difluoro-4-hydroxy-
- 4-Cyano-3,5-difluorophenol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,6-Difluoro-4-hydroxybenzonitrile
CAS:Formula:C7H3F2NOPurity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalineMolecular weight:155.102,6-Difluoro-4-hydroxybenzonitrile
CAS:2,6-Difluoro-4-hydroxybenzonitrileFormula:C7H3F2NOPurity:98%Molecular weight:155.1Benzonitrile, 2,6-difluoro-4-hydroxy-
CAS:Formula:C7H3F2NOPurity:98%Color and Shape:SolidMolecular weight:155.10162,6-Difluoro-4-hydroxybenzonitrile
CAS:2,6-Difluoro-4-hydroxybenzonitrileFormula:C7H3F2NOPurity:98%Color and Shape:White-pale yellow SolidMolecular weight:155.101622,6-Difluoro-4-hydroxybenzonitrile
CAS:Formula:C7H3F2NOPurity:97%Color and Shape:SolidMolecular weight:155.1044-Cyano-3,5-difluorophenol
CAS:4-Cyano-3,5-difluorophenol (4CF) is a mesomorphic compound that has a number of reactions with chloride. 4CF is synthesized from 3,5-difluoroaniline and the reaction product is then heated with chlorine to produce 4CF. The optimal reaction temperature is between 100°C and 120°C. When exposed to light, 4CF will react with chloride ions in the presence of heat to form a hydrophobic chlorinated product. This product reacts with proton donors such as NaOH or KOH to produce hydrogen gas. At room temperature, 4CF can be used as a gas sensor.Formula:C7H3F2NOPurity:Min. 95 Area-%Molecular weight:155.1 g/mol





