CAS 1239358-86-1
:N2-[(1S)-1-(4-Fluorophenyl)ethyl]-4-(1-methyl-1H-pyrazol-4-yl)-N6-2-pyrazinyl-2,6-pyridinediamine
Description:
The chemical substance N2-[(1S)-1-(4-Fluorophenyl)ethyl]-4-(1-methyl-1H-pyrazol-4-yl)-N6-2-pyrazinyl-2,6-pyridinediamine, with CAS number 1239358-86-1, is a complex organic compound characterized by its multi-ring structure and various functional groups. It features a pyridine backbone, which is a nitrogen-containing heterocycle, and incorporates pyrazole and pyrazine moieties, contributing to its potential biological activity. The presence of a fluorophenyl group suggests possible interactions with biological targets, enhancing its lipophilicity and possibly influencing its pharmacokinetic properties. The stereochemistry indicated by the (1S) configuration implies a specific spatial arrangement that may be crucial for its biological function. This compound is likely to exhibit properties relevant to medicinal chemistry, potentially serving as a lead compound in drug discovery, particularly in areas such as oncology or infectious diseases. Its solubility, stability, and reactivity would depend on the specific conditions and the presence of other chemical entities in a given environment.
Formula:C21H20FN7
InChI:InChI=1S/C21H20FN7/c1-14(15-3-5-18(22)6-4-15)26-19-9-16(17-11-25-29(2)13-17)10-20(27-19)28-21-12-23-7-8-24-21/h3-14H,1-2H3,(H2,24,26,27,28)/t14-/m0/s1
InChI key:InChIKey=UQTPDWDAYHAZNT-AWEZNQCLSA-N
SMILES:N(C1=CC(=CC(N[C@@H](C)C2=CC=C(F)C=C2)=N1)C3=CN(C)N=C3)C=4C=NC=CN4
Synonyms:- 2,6-Pyridinediamine, N2-[(1S)-1-(4-fluorophenyl)ethyl]-4-(1-methyl-1H-pyrazol-4-yl)-N6-2-pyrazinyl-
- N2-[(1S)-1-(4-Fluorophenyl)ethyl]-4-(1-methyl-1H-pyrazol-4-yl)-N6-2-pyrazinyl-2,6-pyridinediamine
- (S)-N-[1-(4-Fluorophenyl)ethyl]-4-(1-methyl-1H-pyrazol-4-yl)-N′-(pyrazin-2-yl)pyridine-2,6-diamine
- NS 018
- Ilginatinib
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Ilginatinib
CAS:Ilginatinib (NS-018) is a highly active and orally bioavailable inhibitor of JAK2.Formula:C21H20FN7Purity:98.4% - 99.01%Color and Shape:SolidMolecular weight:389.43Ref: TM-T12266
1mg60.00€1mL*10mM (DMSO)126.00€5mg131.00€10mg177.00€25mg259.00€50mg371.00€100mg532.00€200mg705.00€Ilginatinib
CAS:Ilginatinib is a cell-factor inhibitor that has been identified as a potential therapeutic agent for the treatment of cancers. Ilginatinib inhibits Jak2V617F, which is an oncogenic mutation in the Jak2 gene. This mutation leads to uncontrolled growth and survival of hematopoietic cells, which are cells that produce blood cells. Ilginatinib has been shown to inhibit colony-stimulating factor (CSF), which is an inflammatory cytokine that can lead to tumor progression. The molecular modeling study indicated that ilginatinib may bind with hydrogen bonds to the active site of Jak2V617F and thereby inhibit its activity. It also prevents activation of jak2 v617f by inhibiting epidermal growth factor receptor, which is a cell surface protein. Ilginatinib also inhibits the synthesis of hematopoietic growth factors such as stem cell factor and erythropoietin, leading to decreased proliferation in theseFormula:C21H20FN7Purity:Min. 95%Molecular weight:389.43 g/mol



