CymitQuimica logo

CAS 1242458-49-6

:

6-Amino-4-pyridazinecarboxylic acid

Description:
6-Amino-4-pyridazinecarboxylic acid is a heterocyclic organic compound characterized by its pyridazine ring structure, which features an amino group and a carboxylic acid functional group. This compound is typically represented by a molecular formula that reflects its nitrogen and carbon content, indicative of its aromatic nature. The presence of the amino group suggests potential basicity and the ability to participate in hydrogen bonding, while the carboxylic acid group contributes to its acidity and reactivity in various chemical reactions. This compound may exhibit solubility in polar solvents due to its functional groups, making it useful in various applications, including pharmaceuticals and agrochemicals. Its unique structure allows for potential interactions with biological systems, which may be explored for therapeutic purposes. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its practical applications. Overall, 6-Amino-4-pyridazinecarboxylic acid is a versatile compound with significant implications in chemical research and development.
Formula:C5H5N3O2
InChI:InChI=1S/C5H5N3O2/c6-4-1-3(5(9)10)2-7-8-4/h1-2H,(H2,6,8)(H,9,10)
InChI key:InChIKey=SNLGFUZBTYAQLN-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(N)N=NC1
Synonyms:
  • 6-Amino-4-pyridazinecarboxylic acid
  • 4-Pyridazinecarboxylic acid, 6-amino-
Found 2 products.