CAS 124251-84-9
:1-naphthol-2,3,4,5,6,7,8-D7
Description:
1-Naphthol-2,3,4,5,6,7,8-D7 is a deuterated form of 1-naphthol, a polycyclic aromatic compound characterized by a naphthalene ring with a hydroxyl group (-OH) at the first position. The "D7" designation indicates that the hydrogen atoms in the naphthalene structure have been replaced with deuterium, a stable isotope of hydrogen, which is often used in research to trace chemical reactions or to study molecular dynamics. This compound is typically utilized in various scientific applications, including spectroscopy and as a reference standard in analytical chemistry. Its physical properties, such as melting point and solubility, may differ from those of non-deuterated 1-naphthol due to the isotopic substitution. Additionally, the presence of deuterium can influence the compound's reactivity and interaction with other substances, making it valuable in studies involving kinetic isotope effects. Overall, 1-naphthol-2,3,4,5,6,7,8-D7 serves as an important tool in both organic chemistry and analytical applications.
Formula:C10HD7O
InChI:InChI=1/C10H8O/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7,11H/i1D,2D,3D,4D,5D,6D,7D
SMILES:c1(c(c(c2c(c1[2H])c(c(c(c2O)[2H])[2H])[2H])[2H])[2H])[2H]
Synonyms:- naphthalen-d7-1-ol
- 1-NAPHTHOL-D7
- DISCONTINUED. Offer Alternates.
- 2,3,4,5,6,7,8-heptadeuterionaphthalen-1-ol
- 1-Naphthol-2,3,4,5,6,7,8-d?
- 1-Naphthol-d7 (d6 Major)
- 1-NAPHTHOL-2,3,4,5,6,7,8-D7
- 1-NAPHTHOL-D7 98%
- 1-NAPHTHOL-2,3,4,5,6,7,8-D7, 97 ATOM % D
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Naphthol-2,3,4,5,6,7,8-d7
CAS:Controlled Product1-Naphthol-2,3,4,5,6,7,8-d7 is a chemical that is used as a reaction component in organic syntheses. It is a versatile building block for the synthesis of complex compounds and fine chemicals. 1-Naphthol-2,3,4,5,6,7,8-d7 can be used as a reagent for the production of high quality research chemicals. This compound has been shown to be effective in the synthesis of pharmaceuticals and agrochemicals. 1-Naphthol-2,3,4,5,6,7,8-d7 is an intermediate for the production of other compounds such as pharmaceuticals and pesticides. The CAS number for this chemical is 124251-84-9.
Formula:C10D7HOPurity:Min. 95%Molecular weight:151.21 g/mol




