CymitQuimica logo

CAS 1243244-14-5

:

LGK974

Description:
LGK974, also known by its chemical name, is a small molecule inhibitor that specifically targets the enzyme porcupine, which is involved in the Wnt signaling pathway. This pathway plays a crucial role in various biological processes, including cell proliferation, differentiation, and stem cell maintenance. By inhibiting porcupine, LGK974 effectively reduces the secretion of Wnt ligands, thereby modulating Wnt signaling. This characteristic makes it a potential therapeutic agent in the treatment of various cancers and other diseases associated with aberrant Wnt signaling. LGK974 has been studied in preclinical models for its efficacy and safety profile, showing promise in inhibiting tumor growth. Additionally, its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion, are critical for determining its suitability for clinical use. As research continues, LGK974 may contribute to the development of targeted therapies aimed at conditions where Wnt signaling is dysregulated.
Formula:C23H20N6O
InChI:InChI=1S/C23H20N6O/c1-15-9-17(12-28-23(15)18-5-6-25-16(2)10-18)11-22(30)29-21-4-3-19(13-27-21)20-14-24-7-8-26-20/h3-10,12-14H,11H2,1-2H3,(H,27,29,30)
InChI key:XXYGTCZJJLTAGH-UHFFFAOYSA-N
SMILES:CC1=CC(=CN=C1C2=CC(=NC=C2)C)CC(=O)NC3=NC=C(C=C3)C4=NC=CN=C4
Found 8 products.