CymitQuimica logo

CAS 1243250-11-4

:

5-Chloro-1H-1,2,4-triazole-3-propanoic acid

Description:
5-Chloro-1H-1,2,4-triazole-3-propanoic acid is a chemical compound characterized by its triazole ring structure, which is a five-membered aromatic ring containing three nitrogen atoms. This compound features a chloro substituent at the 5-position and a propanoic acid functional group at the 3-position, contributing to its potential biological activity. It is typically a white to off-white solid and is soluble in polar solvents, which is common for compounds containing carboxylic acid groups. The presence of the triazole moiety suggests potential applications in pharmaceuticals, particularly as a building block in the synthesis of agrochemicals or as a fungicide, due to the biological activity associated with triazole derivatives. Additionally, the chlorine atom may enhance the compound's lipophilicity and influence its interaction with biological targets. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.
Formula:C5H6ClN3O2
InChI:InChI=1S/C5H6ClN3O2/c6-5-7-3(8-9-5)1-2-4(10)11/h1-2H2,(H,10,11)(H,7,8,9)
InChI key:InChIKey=UYZDCYGGFIDYCL-UHFFFAOYSA-N
SMILES:C(CC(O)=O)C=1NC(Cl)=NN1
Synonyms:
  • 1H-1,2,4-Triazole-3-propanoic acid, 5-chloro-
  • 5-Chloro-1H-1,2,4-triazole-3-propanoic acid
Found 1 products.