CAS 124436-59-5
:Pirodavir
Description:
Pirodavir is an antiviral compound primarily investigated for its potential in treating viral infections, particularly those caused by rhinoviruses, which are responsible for the common cold. It belongs to the class of compounds known as nucleoside analogs, which mimic the structure of natural nucleosides and interfere with viral replication. Pirodavir exhibits a mechanism of action that involves inhibiting viral RNA synthesis, thereby preventing the virus from multiplying within host cells. The substance is characterized by its relatively low molecular weight and specific functional groups that contribute to its antiviral activity. In terms of solubility, Pirodavir is typically evaluated in various solvents to determine its bioavailability and pharmacokinetic properties. While it has shown promise in preclinical studies, further research is necessary to fully understand its efficacy, safety profile, and potential therapeutic applications in clinical settings. As with many antiviral agents, the development of resistance and the need for combination therapies are important considerations in its use.
Formula:C21H27N3O3
InChI:InChI=1/C21H27N3O3/c1-3-26-21(25)18-5-7-19(8-6-18)27-15-12-17-10-13-24(14-11-17)20-9-4-16(2)22-23-20/h4-9,17H,3,10-15H2,1-2H3
SMILES:CCOC(=O)c1ccc(cc1)OCCC1CCN(CC1)c1ccc(C)nn1
Synonyms:- Pirodavir [USAN:INN:BAN]
- Benzoic acid, 4-(2-(1-(6-methyl-3-pyridazinyl)-4-piperidinyl)ethoxy)-, ethyl ester
- Ethyl p-(2-(1-(6-methyl-3-pyridazinyl)-4-piperidyl)ethoxy)benzoate
- Pirodavirum
- Pirodavirum [INN-Latin]
- R 77975
- Unii-Bml697718K
- Ethyl 4-{2-[1-(6-Methylpyridazin-3-Yl)Piperidin-4-Yl]Ethoxy}Benzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Benzoic acid, 4-[2-[1-(6-methyl-3-pyridazinyl)-4-piperidinyl]ethoxy]-, ethyl ester
CAS:Formula:C21H27N3O3Purity:99%Color and Shape:SolidMolecular weight:369.4574Ethyl 4-(2-(1-(6-Methylpyridazin-3-Yl)Piperidin-4-Yl)Ethoxy)Benzoate
CAS:Ethyl 4-(2-(1-(6-Methylpyridazin-3-Yl)Piperidin-4-Yl)Ethoxy)BenzoateFormula:C21H27N3O3Purity:≥98%Molecular weight:369.46Pirodavir
CAS:Formula:C21H27N3O3Purity:>95.0%(HPLC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:369.47Pirodavir
CAS:Pirodavir (R77975) (R 77975), the prototype of broad-spectrum anti-picornavirus compounds, is a potent human rhinovirus (HRV) capsid-binding inhibitor.Formula:C21H27N3O3Purity:98.43% - 99.47%Color and Shape:SolidMolecular weight:369.46Ref: TM-T1750
2mg42.00€5mg62.00€1mL*10mM (DMSO)71.00€10mg96.00€25mg210.00€50mg334.00€100mg474.00€200mg642.00€R 77975
CAS:Controlled ProductApplications R 77975 is used to modulate lipophilicity in human rhinovirus capsid binders. It also is used in order to identify potential ativiral agents.
References Morley, A. et al.: Bioorg. Med. Chem. Lett., 21, 6031 (2011); Tomkinson, N. et al.: Bioorg. Med. Chem. Lett., 22, 7494 (2012);Formula:C21H27N3O3Color and Shape:NeatMolecular weight:369.46Pirodavir
CAS:Pirodavir is a potent antiviral compound, which is a synthetic molecule developed through pharmaceutical research. It acts by targeting the rhinovirus, the most common viral infectious agent in humans, primarily responsible for the common cold. Pirodavir's mode of action involves binding to the viral capsid, thereby preventing the uncoating process essential for viral replication.Formula:C21H27N3O3Purity:Min. 95%Molecular weight:369.46 g/mol






