CymitQuimica logo

CAS 1245898-82-1

:

(2-(tert-butoxy)pyridin-3-yl)boronic acid

Description:
(2-(tert-butoxy)pyridin-3-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring. The tert-butoxy group enhances its solubility and stability, making it useful in various chemical applications. This compound typically exhibits properties such as moderate polarity due to the pyridine nitrogen and the boronic acid moiety, which can participate in hydrogen bonding and coordination with other molecules. It is often utilized in organic synthesis, particularly in Suzuki coupling reactions, where it serves as a key intermediate for the formation of carbon-carbon bonds. The presence of the boronic acid group allows for the formation of stable complexes with diols, which can be exploited in sensor technology and drug development. Additionally, the compound's structure suggests potential reactivity under specific conditions, making it a valuable building block in medicinal chemistry and materials science. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C9H14BNO3
InChI:InChI=1S/C9H14BNO3/c1-9(2,3)14-8-7(10(12)13)5-4-6-11-8/h4-6,12-13H,1-3H3
InChI key:HNPJPQRHQRFFOW-UHFFFAOYSA-N
SMILES:B(C1=C(N=CC=C1)OC(C)(C)C)(O)O
Found 4 products.