CymitQuimica logo

CAS 1246527-48-9

:

tert-butyl 4-(methylamino)butanoate hydrochloride

Description:
Tert-butyl 4-(methylamino)butanoate hydrochloride is a chemical compound characterized by its structure, which includes a tert-butyl group and a methylamino functional group attached to a butanoate moiety. This compound is typically a white to off-white crystalline solid, soluble in polar solvents such as water and methanol, due to the presence of the hydrochloride salt form. It is often used in pharmaceutical research and development, particularly in the synthesis of various bioactive molecules. The presence of the methylamino group suggests potential biological activity, possibly influencing its interaction with biological targets. As with many organic compounds, it is essential to handle this substance with care, following appropriate safety protocols, as it may exhibit toxicity or irritant properties. Additionally, its stability and reactivity can be influenced by environmental conditions such as temperature and pH. Overall, tert-butyl 4-(methylamino)butanoate hydrochloride represents a versatile compound in organic synthesis and medicinal chemistry.
Formula:C9H20ClNO2
InChI:InChI=1S/C9H19NO2.ClH/c1-9(2,3)12-8(11)6-5-7-10-4;/h10H,5-7H2,1-4H3;1H
InChI key:KYSYCXRCAOZNEL-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)CCCNC.Cl
Synonyms:
  • N-γ-Methyl-γ-aminobutyric acid t-butyl ester hydrochloride
  • tert-butyl 4-(methylamino)butanoate hydrochloride
Found 6 products.