CymitQuimica logo

CAS 124700-70-5

:

4-Pyrimidinol,2-(methylthio)-

Description:
4-Pyrimidinol, 2-(methylthio)- is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 3 positions. This compound features a hydroxyl group (-OH) at the 4-position and a methylthio group (-S-CH3) at the 2-position, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the hydroxyl group. The methylthio group can influence the compound's reactivity and interactions, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The presence of nitrogen atoms in the ring can also impart basicity, allowing for potential interactions with acids. Overall, 4-Pyrimidinol, 2-(methylthio)- is a versatile compound with potential applications in medicinal chemistry and material science, although specific reactivity and stability would depend on the surrounding conditions and functional groups present in a given reaction.
Formula:C5H6N2OS
InChI:InChI=1S/C5H6N2OS/c1-9-5-6-3-2-4(8)7-5/h2-3H,1H3,(H,6,7,8)
InChI key:UYHSQVMHSFXUOA-UHFFFAOYSA-N
SMILES:CSC1=NC=CC(=O)N1
Found 3 products.