CAS 124763-51-5
:bis-tris hydrochloride
Description:
Bis-Tris hydrochloride is a zwitterionic buffering agent commonly used in biochemical and molecular biology applications. It is a derivative of bis(2-hydroxyethyl)amino-tris(hydroxymethyl)methane, which provides excellent buffering capacity in the physiological pH range, typically around pH 6 to 7.5. This compound is highly soluble in water, making it suitable for various aqueous solutions. Its zwitterionic nature minimizes interference with biological assays, as it does not significantly affect the ionic strength of the solution. Bis-Tris hydrochloride is often utilized in protein purification, enzyme assays, and electrophoresis, where maintaining a stable pH is crucial. Additionally, it is characterized by low toxicity and is compatible with many biological systems, making it a preferred choice in laboratory settings. Its stability and effectiveness as a buffer make it an essential reagent in research and industrial applications involving biological molecules.
Formula:C8H20ClNO5
InChI:InChI=1/C8H19NO5.ClH/c10-3-1-9(2-4-11)8(5-12,6-13)7-14;/h10-14H,1-7H2;1H
SMILES:C(CO)N(CCO)C(CO)(CO)CO.Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-(Bis(2-hydroxyethyl)amino)-2-(hydroxymethyl)propane-1,3-diol hydrochloride
CAS:Formula:C8H20ClNO5Purity:97%Color and Shape:SolidMolecular weight:245.7011Bis(2-hydroxyethyl)aminotris(hydroxymethyl)methane hydrochloride
CAS:Bis(2-hydroxyethyl)aminotris(hydroxymethyl)methane hydrochlorideFormula:C8H19NO5·ClHPurity:>98%Color and Shape:White SolidMolecular weight:245.7011BIS-TRIS hydrochloride
CAS:Formula:C8H19NO5·HClPurity:≥ 98.0% (dried basis)Color and Shape:White crystalline powderMolecular weight:245.70Bis-Tris Hydrochloride
CAS:Bis-Tris Hydrochloride is an amphoteric ion buffer with an effective pH range of 6.0 to 7.5, commonly used in Bis-Tris gel electrophoresisFormula:C8H20ClNO5Color and Shape:SolidMolecular weight:245.7Bis-Tris HCl
CAS:2-(Bis(2-hydroxyethyl)amino)-2-(hydroxymethyl)propane-1,3-diol hydrochlorideFormula:C8H20ClNO5Purity:97%Molecular weight:245.7BIS-TRIS Hydrochloride Buffer extrapure, 98%
CAS:Formula:C8H19NO5·HClPurity:min.98%Color and Shape:White, Crystalline powder, Clear, ColourlessMolecular weight:245.72-(Bis(2-hydroxyethyl)amino)-2-(hydroxymethyl)propane-1,3-diol hydrochloride
CAS:Formula:C8H20ClNO5Purity:97%Color and Shape:SolidMolecular weight:245.7






