CymitQuimica logo

CAS 125274-16-0

:

2,5,8,11-Tetraoxatridecan-13-ol, 1,1,1-triphenyl-

Description:
2,5,8,11-Tetraoxatridecan-13-ol, 1,1,1-triphenyl- is a complex organic compound characterized by its long carbon chain and multiple ether functional groups due to the presence of tetraoxatridecane structure. The compound features a hydroxyl group (-OH) at the terminal position, which contributes to its solubility in polar solvents and potential reactivity in various chemical reactions. The presence of three phenyl groups (triphenyl) indicates significant aromatic character, which can influence the compound's stability, reactivity, and interaction with other molecules. This compound may exhibit interesting properties such as potential surfactant behavior, depending on its molecular structure and the arrangement of its functional groups. Its unique combination of ether linkages and hydroxyl functionality may also suggest applications in materials science or as a precursor in organic synthesis. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C27H32O5
InChI:InChI=1S/C27H32O5/c28-16-17-29-18-19-30-20-21-31-22-23-32-27(24-10-4-1-5-11-24,25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1-15,28H,16-23H2
InChI key:NVNUQXMSFVIKJG-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)OCCOCCOCCOCCO
Found 4 products.