CymitQuimica logo

CAS 1252793-57-9

:

2-(2,3-Dihydro-1H-Inden-4-yl)-4,4,5,5-Tetramethyl-1,3,2-Dioxaborolane

Description:
2-(2,3-Dihydro-1H-Inden-4-yl)-4,4,5,5-Tetramethyl-1,3,2-Dioxaborolane is an organoboron compound characterized by its unique dioxaborolane structure, which features a boron atom bonded to two oxygen atoms in a cyclic arrangement. This compound typically exhibits a high degree of stability due to the presence of the boron-oxygen bond, making it useful in various synthetic applications, particularly in organic synthesis and medicinal chemistry. The presence of the indene moiety contributes to its aromatic characteristics, potentially influencing its reactivity and interaction with other chemical species. Additionally, the tetramethyl substituents enhance its steric bulk, which can affect its solubility and reactivity in different solvents. This compound may serve as a valuable intermediate in the synthesis of more complex organic molecules, including pharmaceuticals and agrochemicals. Its specific properties, such as melting point, boiling point, and solubility, would depend on the conditions under which it is studied, but it is generally handled with standard laboratory precautions due to the reactivity associated with organoboron compounds.
Formula:C15H21BO2
InChI:InChI=1S/C15H21BO2/c1-14(2)15(3,4)18-16(17-14)13-10-6-8-11-7-5-9-12(11)13/h6,8,10H,5,7,9H2,1-4H3
InChI key:DYTLGZWBDATBAZ-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=C3CCCC3=CC=C2
Found 5 products.