CymitQuimica logo

CAS 125292-97-9

:

wallichinine D

Description:
Wallichinine D is a naturally occurring alkaloid derived from various plant sources, particularly those belonging to the genus *Corydalis*. It is characterized by its complex molecular structure, which includes multiple rings and functional groups typical of alkaloids. This compound exhibits notable biological activities, including potential anti-inflammatory and analgesic properties, making it of interest in pharmacological research. The substance is typically studied for its effects on various biological pathways, and its interactions with specific receptors may contribute to its therapeutic potential. In terms of physical properties, wallichinine D is usually found as a crystalline solid, and its solubility can vary depending on the solvent used. As with many alkaloids, it may also exhibit a range of effects on human health, necessitating careful investigation into its safety and efficacy. Overall, wallichinine D represents a fascinating subject for further exploration in both natural product chemistry and medicinal applications.
Formula:C22H26O5
InChI:InChI=1/C22H26O5/c1-7-8-17-14-22(27-6,21(26-5)13-18(17)23)15(2)11-16-9-10-19(24-3)20(12-16)25-4/h7,9-14H,1,8H2,2-6H3/b15-11+
InChI key:VKYZYTYFGUQBLS-RVDMUPIBSA-N
SMILES:C/C(=C\C1=CC(=C(C=C1)OC)OC)/C2(C=C(C(=O)C=C2OC)CC=C)OC
Synonyms:
  • 4-[(E)-2-(3,4-dimethoxyphenyl)-1-methylethenyl]-4,5-dimethoxy-2-prop-2-en-1-ylcyclohexa-2,5-dien-1-one
Found 5 products.