CAS 125306-83-4
:Cafenstrole
Description:
Cafenstrole is a chemical compound classified as a selective herbicide, primarily used in agricultural applications to control various broadleaf weeds and grasses. It belongs to the class of compounds known as phenylpyrimidines. Cafenstrole operates by inhibiting specific enzymes involved in the biosynthesis of certain plant hormones, thereby disrupting the growth and development of target plants. The compound is characterized by its relatively low toxicity to non-target organisms, making it a preferred choice in integrated pest management strategies. Its mode of action is primarily through the inhibition of photosynthesis and other metabolic processes in plants. Cafenstrole is typically applied in pre-emergent and post-emergent formulations, allowing for flexibility in weed management practices. Additionally, it has a moderate environmental persistence, which necessitates careful consideration of application timing and methods to minimize potential impacts on surrounding ecosystems. As with any herbicide, adherence to safety guidelines and regulations is essential to ensure effective and responsible use.
Formula:C16H22N4O3S
InChI:InChI=1S/C16H22N4O3S/c1-6-19(7-2)16(21)20-10-17-15(18-20)24(22,23)14-12(4)8-11(3)9-13(14)5/h8-10H,6-7H2,1-5H3
InChI key:InChIKey=HFEJHAAIJZXXRE-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=NN(C(N(CC)CC)=O)C=N1)C2=C(C)C=C(C)C=C2C
Synonyms:- 1H-1,2,4-Triazole-1-carboxamide, N,N-diethyl-3-[(2,4,6-trimethylphenyl)sulfonyl]-
- Cafenstrole (Pa Iso)
- Ch-900
- Grachitor
- Himeadow
- N,N-diethyl-3-((2,4,6-trimethylphenyl)sulfonyl)-1H-1,2,4-trizole-1-carboxamide
- N,N-diethyl-3-[(2,4,6-trimethylphenyl)sulfonyl]-1H-1,2,4-triazole-1-carboxamide
- N,N-diethyl-3-mesitylsulfonyl-1H-1,2,4-triazol-1-carboxamide
- N,N-diethyl-3-mesitylsulfonyl-1H-1,2,4-triazole-1-carboxamide
- Zuocaoan
- Cafenstrole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N,N-Diethyl-3-(mesitylsulphonyl)-1H-1,2,4-triazole-1-carboximidamide (Cafenstrole)
CAS:N,N-Diethyl-3-(mesitylsulphonyl)-1H-1,2,4-triazole-1-carboximidamide (Cafenstrole)Formula:C16H22N4O3SPurity:95%Molecular weight:350.44Cafenstrole 100 µg/mL in Acetonitrile
CAS:Controlled ProductFormula:C16H22N4O3SColor and Shape:ColourlessMolecular weight:350.44Cafenstrole
CAS:Cafenstrole is a novel inhibitor of lipid biosynthesis that has been shown to have an inhibitory effect on the synthesis of fatty acids in vitro. It also inhibits the production of proteins and nucleic acids, which are necessary for the growth and survival of cells. Cafenstrole has been shown to be synergistic with other drugs such as herbicides, which can provide a selectivity advantage against weeds. This drug is also active against fungi and bacteria, including those resistant to other herbicides. The drug is absorbed by plants easily and can be used as a film-forming polymer in vitro.Formula:C16H22N4O3SPurity:Min. 95%Color and Shape:PowderMolecular weight:350.44 g/molN,N-Diethyl-3-(mesitylsulphonyl)-1H-1,2,4-triazole-1-carboximidamide (Cafenstrole)
CAS:Applications N,N-Diethyl-3-(mesitylsulphonyl)-1H-1,2,4-triazole-1-carboximidamide (Cafenstrole) (cas# 125306-83-4) is a useful research chemical.
Formula:C16H22N4O3SColor and Shape:NeatMolecular weight:350.44



