CymitQuimica logo

CAS 1253792-59-4

:

Methyl 4-formyl-2-iodobenzoate

Description:
Methyl 4-formyl-2-iodobenzoate is an organic compound characterized by its structure, which includes a benzoate moiety with a formyl group and an iodine substituent. This compound features a methyl ester functional group, contributing to its reactivity and solubility properties. The presence of the formyl group indicates that it can participate in various chemical reactions, such as nucleophilic additions or condensation reactions. The iodine atom enhances the compound's electrophilicity, making it a potential candidate for further chemical transformations, including coupling reactions or as a precursor in the synthesis of more complex molecules. Methyl 4-formyl-2-iodobenzoate is typically used in organic synthesis and may serve as an intermediate in the preparation of pharmaceuticals or agrochemicals. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the compound. As with many halogenated compounds, safety precautions should be taken due to potential toxicity and environmental impact.
Formula:C9H7IO3
InChI:InChI=1S/C9H7IO3/c1-13-9(12)7-3-2-6(5-11)4-8(7)10/h2-5H,1H3
InChI key:InChIKey=LPRLKXULYATVAA-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(I)C=C(C=O)C=C1
Synonyms:
  • Methyl 4-formyl-2-iodobenzoate
  • Benzoic acid, 4-formyl-2-iodo-, methyl ester
Found 1 products.