CymitQuimica logo

CAS 1255206-67-7

:

5-Bromo-4-methyl-2-benzofuran-1(3H)-one

Description:
5-Bromo-4-methyl-2-benzofuran-1(3H)-one is a chemical compound characterized by its unique structure, which includes a benzofuran moiety substituted with a bromine atom and a methyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the benzofuran ring. The bromine substitution can influence its reactivity and solubility, making it of interest in various synthetic applications. The presence of the carbonyl group in the structure suggests that it may participate in nucleophilic addition reactions. Additionally, compounds like this one are often studied for their potential pharmacological properties, including antimicrobial or anti-inflammatory effects. Its specific melting point, boiling point, and solubility characteristics would depend on the purity and specific conditions of the environment in which it is analyzed. Overall, 5-Bromo-4-methyl-2-benzofuran-1(3H)-one represents a class of compounds that can be valuable in medicinal chemistry and organic synthesis.
Formula:C9H7BrO2
InChI:InChI=1S/C9H7BrO2/c1-5-7-4-12-9(11)6(7)2-3-8(5)10/h2-3H,4H2,1H3
InChI key:InChIKey=IRAKZLQFUGTIGE-UHFFFAOYSA-N
SMILES:CC1=C2C(C(=O)OC2)=CC=C1Br
Synonyms:
  • 1(3H)-Isobenzofuranone, 5-bromo-4-methyl-
  • 5-Bromo-4-methyl-1(3H)-isobenzofuranone
  • 5-Bromo-4-methyl-2-benzofuran-1(3H)-one
Found 3 products.