CymitQuimica logo

CAS 1255529-24-8

:

EthanediaMide, N1-(5-chloro-2-pyridinyl)-N2-[(1R,2R,4R)-4-[(diMethylaMino)carbonyl]-2-[[(4,5,6,7-tetrahydro-5-Methylthiazolo[5,4-c]pyridin-2-yl)carbonyl]aMino]cyclohexyl]-

Description:
Ethanediamide, N1-(5-chloro-2-pyridinyl)-N2-[(1R,2R,4R)-4-[(dimethylamino)carbonyl]-2-[[(4,5,6,7-tetrahydro-5-methylthiazolo[5,4-c]pyridin-2-yl)carbonyl]amino]cyclohexyl]- is a complex organic compound characterized by its multi-functional structure, which includes an ethanediamide backbone and various substituents that contribute to its biological activity. The presence of a chloro group and a pyridine ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The dimethylamino and thiazole moieties indicate possible roles in enhancing solubility and bioactivity. This compound may exhibit specific pharmacological properties, potentially acting as an inhibitor or modulator in biochemical pathways. Its structural complexity implies that it could be subject to various metabolic processes, influencing its efficacy and safety profile. As with many compounds of this nature, understanding its characteristics, including solubility, stability, and reactivity, is crucial for its application in research or therapeutic contexts.
Formula:C24H30ClN7O4S
InChI:InChI=1S/C24H30ClN7O4S/c1-31(2)24(36)13-4-6-15(27-20(33)21(34)30-19-7-5-14(25)11-26-19)17(10-13)28-22(35)23-29-16-8-9-32(3)12-18(16)37-23/h5,7,11,13,15,17H,4,6,8-10,12H2,1-3H3,(H,27,33)(H,28,35)(H,26,30,34)/t13-,15-,17-/m1/s1
InChI key:HGVDHZBSSITLCT-FRFSOERESA-N
SMILES:CN1CCC2=C(C1)SC(=N2)C(=O)N[C@@H]3C[C@@H](CC[C@H]3NC(=O)C(=O)NC4=NC=C(C=C4)Cl)C(=O)N(C)C
Found 7 products.