CymitQuimica logo

CAS 1255666-29-5

:

1-(1,1-Dimethylethyl) 2-methyl 1,2,4-piperidinetricarboxylate

Description:
1-(1,1-Dimethylethyl) 2-methyl 1,2,4-piperidinetricarboxylate, identified by its CAS number 1255666-29-5, is a chemical compound characterized by its piperidine structure, which includes a piperidine ring substituted with multiple carboxylate groups. This compound features a tert-butyl group (1,1-dimethylethyl) and a methyl group, contributing to its steric bulk and potentially influencing its reactivity and solubility. The presence of three carboxylate groups suggests that it may exhibit acidic properties and could participate in various chemical reactions, such as esterification or amidation. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the compound's unique substituents may affect its biological activity, making it a candidate for further research in drug design or synthesis. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally for practical applications.
Formula:C13H21NO6
InChI:InChI=1S/C13H21NO6/c1-13(2,3)20-12(18)14-6-5-8(10(15)16)7-9(14)11(17)19-4/h8-9H,5-7H2,1-4H3,(H,15,16)
InChI key:InChIKey=VPZOZPSOJLQFGC-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1N(C(OC(C)(C)C)=O)CCC(C(O)=O)C1
Synonyms:
  • 1-(tert-Butoxycarbonyl)-2-(methoxycarbonyl)-piperidine-4-carboxylic acid
  • 1-(1,1-Dimethylethyl) 2-methyl 1,2,4-piperidinetricarboxylate
  • 1,2,4-Piperidinetricarboxylic acid, 1-(1,1-dimethylethyl) 2-methyl ester
Found 3 products.