CymitQuimica logo

CAS 1256346-45-8

:

B-(2,4-Dichloro-5-propoxyphenyl)boronic acid

Description:
B-(2,4-Dichloro-5-propoxyphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is substituted with two chlorine atoms and a propoxy group. This compound typically exhibits properties common to boronic acids, such as the ability to form reversible complexes with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the dichloro and propoxy substituents can influence its reactivity, solubility, and overall stability. Boronic acids are often utilized in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds in organic synthesis. Additionally, the specific substituents on the phenyl ring can affect the electronic properties of the compound, potentially enhancing its reactivity or selectivity in chemical reactions. Overall, B-(2,4-Dichloro-5-propoxyphenyl)boronic acid is a versatile compound with significant implications in synthetic organic chemistry and material science.
Formula:C9H11BCl2O3
InChI:InChI=1S/C9H11BCl2O3/c1-2-3-15-9-4-6(10(13)14)7(11)5-8(9)12/h4-5,13-14H,2-3H2,1H3
InChI key:InChIKey=IGWAPOTUMUZOAX-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(Cl)C=C(Cl)C(OCCC)=C1
Synonyms:
  • B-(2,4-Dichloro-5-propoxyphenyl)boronic acid
  • Boronic acid, B-(2,4-dichloro-5-propoxyphenyl)-
Found 4 products.