CymitQuimica logo

CAS 1256360-00-5

:

1-Boc-6-Methoxyindole-3-boronic acid, pinacol ester

Description:
1-Boc-6-Methoxyindole-3-boronic acid, pinacol ester is a chemical compound characterized by its boronic acid functionality, which is typically used in organic synthesis, particularly in Suzuki coupling reactions. The "Boc" (tert-butyloxycarbonyl) group serves as a protecting group for amines, enhancing the compound's stability and reactivity during synthetic procedures. The methoxy group at the 6-position of the indole ring contributes to the compound's electronic properties, influencing its reactivity and solubility. The pinacol ester formation indicates that the boronic acid is in its esterified form, which can improve its stability and handling in various chemical reactions. This compound is likely to be soluble in organic solvents and may exhibit moderate to high stability under standard laboratory conditions. Its unique structure makes it a valuable intermediate in the synthesis of more complex organic molecules, particularly in medicinal chemistry and materials science. As with all boronic acids, care should be taken in handling due to potential reactivity with diols and other nucleophiles.
Formula:C20H28BNO5
InChI:InChI=1S/C20H28BNO5/c1-18(2,3)25-17(23)22-12-15(14-10-9-13(24-8)11-16(14)22)21-26-19(4,5)20(6,7)27-21/h9-12H,1-8H3
InChI key:NEVYMHCTIQBRQU-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CN(C3=C2C=CC(=C3)OC)C(=O)OC(C)(C)C
Synonyms:
  • tert-Butyl 6-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-1-carboxylate
  • 1H-Indole-1-carboxylic acid, 6-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, 1,1-dimethylethyl ester
  • 1-Boc-6-Methoxyindole-3-boronic acid, pinacol ester
Found 4 products.