CymitQuimica logo

CAS 1256825-12-3

:

2,3-Dihydro-6-methyl-4H-pyrano[2,3-b]pyridin-4-one

Description:
2,3-Dihydro-6-methyl-4H-pyrano[2,3-b]pyridin-4-one is a heterocyclic organic compound characterized by its fused pyridine and pyran rings. This compound features a dihydro-pyran moiety, which contributes to its stability and reactivity. The presence of a methyl group at the 6-position of the pyran ring influences its chemical properties, potentially affecting its solubility and interaction with biological systems. The compound may exhibit various functional properties, including potential biological activity, making it of interest in medicinal chemistry. Its structure suggests that it could participate in hydrogen bonding and other intermolecular interactions, which are crucial for its reactivity and potential applications. Additionally, the compound's unique ring system may allow for diverse synthetic pathways, making it a valuable target for further research in organic synthesis and drug development. As with many heterocycles, its properties can be influenced by substituents and the overall molecular environment, which is essential for understanding its behavior in different chemical contexts.
Formula:C9H9NO2
InChI:InChI=1S/C9H9NO2/c1-6-4-7-8(11)2-3-12-9(7)10-5-6/h4-5H,2-3H2,1H3
InChI key:InChIKey=VXTSRIDMZMYTNE-UHFFFAOYSA-N
SMILES:O=C1C=2C(=NC=C(C)C2)OCC1
Synonyms:
  • 2,3-Dihydro-6-methyl-4H-pyrano[2,3-b]pyridin-4-one
  • 4H-Pyrano[2,3-b]pyridin-4-one, 2,3-dihydro-6-methyl-
Found 2 products.