CAS 125697-63-4
:Carbamic acid, [6-[(2,5-dioxo-1-pyrrolidinyl)oxy]-6-oxohexyl]-,9H-fluoren-9-ylmethyl ester
Description:
Carbamic acid, [6-[(2,5-dioxo-1-pyrrolidinyl)oxy]-6-oxohexyl]-, 9H-fluoren-9-ylmethyl ester, with CAS number 125697-63-4, is a synthetic organic compound characterized by its complex structure, which includes a carbamic acid moiety and a fluorenylmethyl ester group. This compound features a pyrrolidinyl unit that contributes to its potential biological activity, possibly influencing its interaction with various biological targets. The presence of multiple functional groups, including carbonyls and esters, suggests that it may exhibit diverse reactivity and solubility properties. Typically, such compounds are of interest in medicinal chemistry and drug development due to their potential pharmacological effects. The stability and reactivity of this compound can be influenced by environmental factors such as pH and temperature. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods for structural elucidation. Overall, this compound represents a class of molecules that may have applications in therapeutic contexts, although specific biological activities would require further investigation.
Formula:C25H26N2O6
InChI:InChI=1S/C25H26N2O6/c28-22-13-14-23(29)27(22)33-24(30)12-2-1-7-15-26-25(31)32-16-21-19-10-5-3-8-17(19)18-9-4-6-11-20(18)21/h3-6,8-11,21H,1-2,7,12-16H2,(H,26,31)
InChI key:PDKIOJMIJUXCND-UHFFFAOYSA-N
SMILES:C1CC(=O)N(C1=O)OC(=O)CCCCCNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2,5-Dioxopyrrolidin-1-Yl 6-((((9H-Fluoren-9-Yl)Methoxy)Carbonyl)Amino)Hexanoate
CAS:2,5-Dioxopyrrolidin-1-Yl 6-((((9H-Fluoren-9-Yl)Methoxy)Carbonyl)Amino)HexanoateFormula:C25H26N2O6Purity:>99%Molecular weight:450.482,5-Dioxopyrrolidin-1-yl 6-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)hexanoate
CAS:Formula:C25H26N2O6Purity:95%Color and Shape:SolidMolecular weight:450.4837FmocNH-C5-NHS
CAS:2,5-Dioxopyrrolidin-1-yl 6-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)hexanoateFormula:C25H26N2O6Purity:95%Molecular weight:450.48Fmoc-6-aminohexanoic acid N-hydroxysuccinimide ester
CAS:Fmoc-6-aminohexanoic acid N-hydroxysuccinimide ester is a versatile building block that can be used in the synthesis of complex compounds. It is also a reagent, speciality chemical, and useful scaffold, which are all needed for research purposes. Fmoc-6-aminohexanoic acid N-hydroxysuccinimide ester has been used as a useful intermediate in the synthesis of peptides and as reaction components for organic reactions. Fmoc-6-aminohexanoic acid N-hydroxysuccinimide ester can be synthesized using an efficient process that is suitable for large scale production. It has CAS No. 125697-63-4 and was first developed by scientists at BASF SE.Formula:C25H26N2O6Purity:Min. 95 Area-%Color and Shape:White Off-White PowderMolecular weight:450.48 g/mol2,5-Dioxopyrrolidin-1-yl 6-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)hexanoate
CAS:Purity:97%Molecular weight:450.4909973




