CAS 125697-91-8
:lavendustin B
Description:
Lavendustin B is a naturally occurring compound that belongs to the class of indolocarbazole alkaloids. It is primarily derived from the plant species *Lindernia* and has garnered interest due to its potential biological activities, particularly in the field of cancer research. The compound exhibits notable properties as a protein kinase inhibitor, which suggests its role in modulating various cellular signaling pathways. Lavendustin B has been studied for its ability to inhibit specific kinases involved in cell proliferation and survival, making it a candidate for therapeutic applications in oncology. Additionally, it has shown promise in exhibiting anti-inflammatory and antimicrobial activities. The molecular structure of lavendustin B features a complex arrangement that contributes to its biological efficacy. As with many natural products, further research is necessary to fully elucidate its mechanisms of action, potential side effects, and therapeutic windows. Overall, lavendustin B represents a significant area of interest for drug discovery and development in medicinal chemistry.
Formula:C21H19NO5
InChI:InChI=1/C21H19NO5/c23-18-7-3-1-5-14(18)12-22(13-15-6-2-4-8-19(15)24)16-9-10-20(25)17(11-16)21(26)27/h1-11,23-25H,12-13H2,(H,26,27)
SMILES:c1ccc(c(c1)CN(Cc1ccccc1O)c1ccc(c(c1)C(=O)O)O)O
Synonyms:- 5-(Bis((2-hydroxyphenyl)methyl)amino)-2-hydroxybenzoic acid
- Benzoic acid, 5-(bis((2-hydroxyphenyl)methyl)amino)-2-hydroxy-
- 5-[Bis(2-Hydroxybenzyl)Amino]-2-Hydroxybenzoic Acid
- Lavendustin B
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Lavendustin B
CAS:Formula:C21H19NO5Purity:>95.0%(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:365.39Benzoic acid, 5-[bis[(2-hydroxyphenyl)methyl]amino]-2-hydroxy-
CAS:Formula:C21H19NO5Purity:99%Color and Shape:SolidMolecular weight:365.3793lavendustin B
CAS:Lavendustin B inhibits Tyrosine Kinase and HIV-1 integrase-LEDGF/p75 interaction.Formula:C21H19NO5Purity:95.72%Color and Shape:Off-White SolidMolecular weight:365.38Lavendustin B
CAS:5-(Bis(2-hydroxybenzyl)amino)-2-hydroxybenzoic acidFormula:C21H19NO5Purity:99%Molecular weight:365.38Lavendustin B
CAS:Lavendustin B is a potent tyrosine kinase inhibitor, which is a synthetic compound originally derived from certain fungi. It functions by specifically targeting and inhibiting the activity of tyrosine kinases, enzymes that play critical roles in the signaling pathways regulating cell division, growth, and differentiation. This inhibition disrupts phosphorylation processes crucial for oncogenic signal transduction, providing a valuable tool for studying cellular mechanisms involved in tumorigenesis.
Formula:C21H19NO5Purity:Min. 95%Molecular weight:365.38 g/mol





