CymitQuimica logo

CAS 1257092-36-6

:

1-Methyl-5-trifluoroMethyl-1H-indole-2-carboxylic acid

Description:
1-Methyl-5-trifluoromethyl-1H-indole-2-carboxylic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a methyl group at the 1-position and a trifluoromethyl group at the 5-position contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The carboxylic acid functional group at the 2-position enhances its acidity and reactivity, making it a candidate for various chemical reactions, such as esterification or amidation. This compound may exhibit interesting pharmacological properties due to its structural features, which can influence interactions with biological targets. Additionally, the trifluoromethyl group is known to enhance metabolic stability and bioavailability in drug design. Overall, 1-Methyl-5-trifluoromethyl-1H-indole-2-carboxylic acid is a compound of interest in medicinal chemistry and materials science, with potential applications in pharmaceuticals and agrochemicals.
Formula:C11H8F3NO2
InChI:InChI=1S/C11H8F3NO2/c1-15-8-3-2-7(11(12,13)14)4-6(8)5-9(15)10(16)17/h2-5H,1H3,(H,16,17)
InChI key:BJHNBAXVLXMLIM-UHFFFAOYSA-N
SMILES:CN1C2=C(C=C(C=C2)C(F)(F)F)C=C1C(=O)O
Synonyms:
  • 1-Methyl-5-trifluoroMethyl-1H-indole-2-carboxylic acid
  • 1H-Indole-2-carboxylic acid, 1-methyl-5-(trifluoromethyl)-
Found 4 products.