
CAS 1257517-67-1
:D-Streptamine, O-3-amino-3-deoxy-α-D-glucopyranosyl-(1→6)-O-[6-amino-6-deoxy-α-D-glucopyranosyl-(1→4)]-N1-[(2S)-4-amino-2-hydroxy-1-oxobutyl]-2-deoxy-, hydrate (1:?)
Description:
D-Streptamine, O-3-amino-3-deoxy-α-D-glucopyranosyl-(1→6)-O-[6-amino-6-deoxy-α-D-glucopyranosyl-(1→4)]-N1-[(2S)-4-amino-2-hydroxy-1-oxobutyl]-2-deoxy-, hydrate (1:?) is a complex glycosylated aminoglycoside compound. It features multiple sugar moieties, specifically two deoxy sugars linked through glycosidic bonds, which contribute to its structural complexity and biological activity. The presence of amino and hydroxy functional groups suggests potential interactions with biological targets, making it relevant in pharmacology, particularly in antibiotic development. The compound's hydrate form indicates that it contains water molecules in its crystalline structure, which can influence its solubility and stability. Its CAS number, 1257517-67-1, allows for precise identification in chemical databases. Overall, this substance is characterized by its intricate structure, which is essential for its function and efficacy in medicinal applications, particularly in combating bacterial infections.
Formula:C22H43N5O13·xH2O
InChI:InChI=1S/C22H43N5O13.H2O/c23-2-1-8(29)20(36)27-7-3-6(25)18(39-22-16(34)15(33)13(31)9(4-24)37-22)17(35)19(7)40-21-14(32)11(26)12(30)10(5-28)38-21;/h6-19,21-22,28-35H,1-5,23-26H2,(H,27,36);1H2/t6-,7+,8-,9+,10+,11-,12+,13+,14+,15-,16+,17-,18+,19-,21+,22+;/m0./s1
InChI key:InChIKey=DTSOZYYWEZJFSS-XTHCGPPUSA-N
SMILES:O([C@H]1[C@H](NC([C@H](CCN)O)=O)C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O)[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O.O
Synonyms:- D-Streptamine, O-3-amino-3-deoxy-α-D-glucopyranosyl-(1→6)-O-[6-amino-6-deoxy-α-D-glucopyranosyl-(1→4)]-N1-[(2S)-4-amino-2-hydroxy-1-oxobutyl]-2-deoxy-, hydrate (1:?)
- Amikacin hydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Amikacin hydrate
CAS:Formula:C22H43N5O13·xH2OPurity:95.0 - 102.0 % (anhydrous basis)Color and Shape:White or almost white powderMolecular weight:585.60 (anhydrous)Amikacin hydrate 100 µg/mL in Acetonitrile:Water
CAS:Controlled ProductFormula:C22H43N5O13·H2OColor and Shape:Single SolutionMolecular weight:603.62Amikacin hydrate
CAS:Amikacin hydrate (BAY 41-6551 hydrate) is an aminoglycoside antibiotic with bacteriostatic properties.Formula:C22H43N5O13·xH2OPurity:99.98%Color and Shape:SolidMolecular weight:603.62Amikacin hydrate
CAS:Inhibitor of protein synthesis; aminoglycoside
Formula:C22H43N5O13·xH2OPurity:Min. 900 Μg/MgColor and Shape:PowderMolecular weight:585.6 g/molAmikacin hydrate, Antibiotic for Culture Media Use Only
CAS:Amikacin hydrate is an aminoglycoside antibiotic, which is derived from kanamycin through a semi-synthetic process. It functions by binding to the 30S subunit of the bacterial ribosome, thereby inhibiting protein synthesis and leading to errors in the translation process. This disruption is bactericidal, effectively eliminating bacterial pathogens.Formula:C22H43N5O13·xH2OPurity:Min. 90.0%Molecular weight:585.6 g/molAmikacin Hydrate
CAS:Controlled ProductApplications Amikacin hydrate (CAS# 1257517-67-1) is a useful research chemical compound.
Formula:C22H43N5O13·H2OColor and Shape:White To Off-WhiteMolecular weight:603.62






