
CAS 1258292-64-6
:2,6-dichloro-N-(2-(cyclopropanecarboxamido)pyridin-4-yl)benzamide
Description:
2,6-Dichloro-N-(2-(cyclopropanecarboxamido)pyridin-4-yl)benzamide is a synthetic organic compound characterized by its complex structure, which includes a benzamide core substituted with two chlorine atoms at the 2 and 6 positions, and a pyridine ring linked to a cyclopropanecarboxamide moiety. This compound is typically classified as a pharmaceutical intermediate or a potential drug candidate, often investigated for its biological activity, particularly in the context of medicinal chemistry. The presence of the dichloro substituents may influence its lipophilicity and biological interactions, while the cyclopropanecarboxamide group can contribute to its pharmacological properties. The compound's molecular structure suggests potential interactions with biological targets, making it of interest in drug development. Additionally, its solubility, stability, and reactivity can vary based on environmental conditions, which are crucial for its application in research and industry. As with many compounds of this nature, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C16H13Cl2N3O2
InChI:InChI=1S/C16H13Cl2N3O2/c17-11-2-1-3-12(18)14(11)16(23)20-10-6-7-19-13(8-10)21-15(22)9-4-5-9/h1-3,6-9H,4-5H2,(H2,19,20,21,22,23)
InChI key:IAFNAEGXTKTGHN-UHFFFAOYSA-N
SMILES:C1CC1C(=O)NC2=NC=CC(=C2)NC(=O)C3=C(C=CC=C3Cl)Cl
Synonyms:- Benzamide, 2,6-dichloro-N-[2-[(cyclopropylcarbonyl)amino]-4-pyridinyl]-
- 2,6-dichloro-N-(2-(cyclopropanecarboxamido)pyridin-4-yl)benzamide
- GDC-046
- GDC-046;GDC 046
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2,6-Dichloro-N-(2-(cyclopropanecarboxamido)pyridin-4-yl)benzamide
CAS:2,6-Dichloro-N-(2-(cyclopropanecarboxamido)pyridin-4-yl)benzamideFormula:C16H13Cl2N3O2Purity:≥98%Molecular weight:350.22,6-Dichloro-N-(2-(Cyclopropanecarboxamido)Pyridin-4-Yl)Benzamide
CAS:2,6-Dichloro-N-(2-(Cyclopropanecarboxamido)Pyridin-4-Yl)BenzamideFormula:C16H13Cl2N3O2Purity:99% NMRMolecular weight:350.2GDC046
CAS:2,6-Dichloro-N-(2-(cyclopropanecarboxamido)pyridin-4-yl)benzamideFormula:C16H13Cl2N3O2Purity:99% NMRMolecular weight:350.22,6-Dichloro-N-(2-(cyclopropanecarboxamido)pyridin-4-yl)benzamide
CAS:2,6-Dichloro-N-(2-(cyclopropanecarboxamido)pyridin-4-yl)benzamide (GDC046), a potent lead analog, has good kinase selectivity and physicochemical properties.Formula:C16H13Cl2N3O2Purity:98.77%Color and Shape:White SolidMolecular weight:350.22,6-Dichloro-N-(2-(cyclopropanecarboxamido)pyridin-4-yl)benzamide
CAS:Purity:99%Molecular weight:350.2GDC046
CAS:GDC046 is a triazole compound with inhibitory properties that acts as a tyrosine kinase inhibitor. It binds to the active site of the enzyme and prevents ATP from binding, inhibiting the enzyme's activity. GDC046 has shown efficacy in vitro against several cancer cell lines and has been found to be safe in vivo. GDC046 has also been found to be selective for the target enzyme, which minimizes off-target effects.Formula:C16H13Cl2N3O2Purity:Min. 95%Molecular weight:350.2 g/molRef: 3D-IAC29264
Discontinued product






