CymitQuimica logo

CAS 1258292-64-6

:

2,6-dichloro-N-(2-(cyclopropanecarboxamido)pyridin-4-yl)benzamide

Description:
2,6-Dichloro-N-(2-(cyclopropanecarboxamido)pyridin-4-yl)benzamide is a synthetic organic compound characterized by its complex structure, which includes a benzamide core substituted with two chlorine atoms at the 2 and 6 positions, and a pyridine ring linked to a cyclopropanecarboxamide moiety. This compound is typically classified as a pharmaceutical intermediate or a potential drug candidate, often investigated for its biological activity, particularly in the context of medicinal chemistry. The presence of the dichloro substituents may influence its lipophilicity and biological interactions, while the cyclopropanecarboxamide group can contribute to its pharmacological properties. The compound's molecular structure suggests potential interactions with biological targets, making it of interest in drug development. Additionally, its solubility, stability, and reactivity can vary based on environmental conditions, which are crucial for its application in research and industry. As with many compounds of this nature, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C16H13Cl2N3O2
InChI:InChI=1S/C16H13Cl2N3O2/c17-11-2-1-3-12(18)14(11)16(23)20-10-6-7-19-13(8-10)21-15(22)9-4-5-9/h1-3,6-9H,4-5H2,(H2,19,20,21,22,23)
InChI key:IAFNAEGXTKTGHN-UHFFFAOYSA-N
SMILES:C1CC1C(=O)NC2=NC=CC(=C2)NC(=O)C3=C(C=CC=C3Cl)Cl
Synonyms:
  • Benzamide, 2,6-dichloro-N-[2-[(cyclopropylcarbonyl)amino]-4-pyridinyl]-
  • 2,6-dichloro-N-(2-(cyclopropanecarboxamido)pyridin-4-yl)benzamide
  • GDC-046
  • GDC-046;GDC 046
Found 7 products.