CymitQuimica logo

CAS 1258651-05-6

:

4-[[(1,1-Dimethylethoxy)carbonyl]amino]-3,3-difluorobutanoic acid

Description:
4-[[(1,1-Dimethylethoxy)carbonyl]amino]-3,3-difluorobutanoic acid is a synthetic organic compound characterized by its unique functional groups and structural features. It contains an amino group, a carboxylic acid, and a difluorobutanoic acid moiety, which contribute to its potential reactivity and biological activity. The presence of the 1,1-dimethylethoxycarbonyl group suggests that it may serve as a protective group in synthetic chemistry, particularly in peptide synthesis or other organic transformations. The difluorobutanoic acid portion indicates that the compound may exhibit interesting properties due to the electronegative fluorine atoms, which can influence the compound's polarity, solubility, and interaction with biological targets. Additionally, the compound's structure may allow for various applications in medicinal chemistry, agrochemicals, or materials science. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound represents a versatile building block in organic synthesis and pharmaceutical development.
Formula:C9H15F2NO4
InChI:InChI=1S/C9H15F2NO4/c1-8(2,3)16-7(15)12-5-9(10,11)4-6(13)14/h4-5H2,1-3H3,(H,12,15)(H,13,14)
InChI key:InChIKey=SHPUQCXPJRHLEK-UHFFFAOYSA-N
SMILES:C(NC(OC(C)(C)C)=O)C(CC(O)=O)(F)F
Synonyms:
  • 4-[[(1,1-Dimethylethoxy)carbonyl]amino]-3,3-difluorobutanoic acid
  • Butanoic acid, 4-[[(1,1-dimethylethoxy)carbonyl]amino]-3,3-difluoro-
Found 2 products.