CAS 126-33-0: Sulfolane

Description:Sulfolane, with the CAS number 126-33-0, is a cyclic sulfone characterized by its colorless, odorless liquid form at room temperature. It has a high boiling point and is known for its excellent solvent properties, particularly in the extraction and purification processes of various organic compounds. Sulfolane is polar and aprotic, making it effective in dissolving a wide range of polar and nonpolar substances. Its chemical structure features a five-membered ring containing a sulfur atom and a carbonyl group, contributing to its stability and reactivity. Sulfolane is also hygroscopic, meaning it can absorb moisture from the air. It is commonly used in the petrochemical industry for the extraction of aromatics from aliphatic hydrocarbons and in the production of certain pharmaceuticals. While generally considered to have low toxicity, proper handling and safety measures are recommended due to its potential environmental impact and the need for careful disposal.

Formula:C₄H₈O₂S

InChI:InChI=1S/C4H8O2S/c5-7(6)3-1-2-4-7/h1-4H2

InChI key:InChIKey=HXJUTPCZVOIRIF-UHFFFAOYSA-N

SMILES:O=S1(=O)CCCC1