CAS 126-96-5
:Sodium diacetate
Description:
Sodium diacetate is a chemical compound with the formula C4H7NaO4, commonly recognized as the sodium salt of acetic acid. It appears as a white, crystalline powder and is highly soluble in water, making it useful in various applications. This compound is often utilized as a food preservative and flavoring agent due to its ability to impart a mild vinegar taste while also acting as a buffering agent. Sodium diacetate is known for its antimicrobial properties, which help inhibit the growth of certain bacteria and fungi, thereby extending the shelf life of food products. Additionally, it finds applications in the pharmaceutical and cosmetic industries, where it can serve as a pH regulator. The compound is generally regarded as safe when used in appropriate amounts, but like any chemical, it should be handled with care to avoid potential irritation. Its stability and effectiveness in various pH environments make it a versatile additive in both food and non-food applications.
Formula:C2H4O2Na
InChI:InChI=1S/C2H4O2.Na/c1-2(3)4;/h1H3,(H,3,4);
InChI key:InChIKey=BDKZHNJTLHOSDW-UHFFFAOYSA-N
SMILES:C(C)(O)=O.[Na]
Synonyms:- Sodium diacetate acid
- Sodium diacetate
- SDA
- Dykon
- Acetic acid, sodium salt, compd. with acetic acid (1:1)
- Acetic acid, sodium salt (2:1)
- Sodium acid acetate
- sodium acetate - acetic acid (1:1:1)
- sodium hydrogen di-acetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Acetic acid, sodium salt (2:1)
CAS:Formula:C4H7NaO4Purity:99%Color and Shape:SolidMolecular weight:142.0857Sodium Acetate Buffer Solution
CAS:Sodium Acetate Buffer SolutionFormula:C4H7NaO4Purity:>98%Color and Shape:LiquidMolecular weight:142.09Sodium diacetate
CAS:Sodium diacetate, a colorless solid, is a flavor enhancer and antimicrobial used widely in food additives.Formula:C4H7NaO4Purity:98%Color and Shape:SolidMolecular weight:142.09Sodium diacetate
CAS:Sodium diacetate is a food additive that is used as a preservative and flavoring agent. It is often combined with sodium benzoate, sodium citrate, and sodium erythorbate to prevent spoilage by mold or yeast. Sodium diacetate also has antimicrobial properties that are comparable to those of sodium carbonate and dimethyl fumarate. It has been shown to inhibit the growth of some bacteria including monocytogenes, typhimurium, and propionibacterium acnes. This compound also reduces the pH of food products by neutralizing acids.Formula:C4H7NaO4Purity:Min. 95%Molecular weight:142.09 g/molRef: 3D-AAA12696
Discontinued product






