CymitQuimica logo

CAS 1260658-98-7

:

1-Methyl-5-(trifluoromethyl)-1H-pyrazole-3-acetic acid

Description:
1-Methyl-5-(trifluoromethyl)-1H-pyrazole-3-acetic acid is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a methyl group at the 1-position and a trifluoromethyl group at the 5-position contributes to its unique properties, including increased lipophilicity and potential biological activity. The acetic acid functional group at the 3-position introduces acidity to the molecule, which can influence its reactivity and solubility in various solvents. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its trifluoromethyl group is known to enhance metabolic stability and bioactivity. Additionally, the compound's molecular structure suggests potential applications in agrochemicals or pharmaceuticals, particularly in the development of new therapeutic agents. As with many pyrazole derivatives, it may also be involved in various chemical reactions, including nucleophilic substitutions and coupling reactions, which can be exploited in synthetic organic chemistry.
Formula:C7H7F3N2O2
InChI:InChI=1S/C7H7F3N2O2/c1-12-5(7(8,9)10)2-4(11-12)3-6(13)14/h2H,3H2,1H3,(H,13,14)
InChI key:InChIKey=WVMGROBMQQTIMY-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(CC(O)=O)=NN1C
Synonyms:
  • 1H-Pyrazole-3-acetic acid, 1-methyl-5-(trifluoromethyl)-
  • 1-Methyl-5-(trifluoromethyl)-1H-pyrazole-3-acetic acid
  • 2-(1-Methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl) acetic acid
  • 2-[1-Methyl-5-(trifluoromethyl)pyrazol-3-yl]acetic acid
Found 1 products.