CymitQuimica logo

CAS 1260670-03-8

:

1H-Pyrazolo[4,3-b]pyridine-5-carboxylic acid

Description:
1H-Pyrazolo[4,3-b]pyridine-5-carboxylic acid is a heterocyclic organic compound characterized by its pyrazolo and pyridine ring structures. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. It typically appears as a crystalline solid and is soluble in polar solvents, reflecting its polar functional groups. The presence of both nitrogen atoms in the pyrazolo and pyridine rings imparts unique electronic properties, making it of interest in medicinal chemistry and drug development. Its structural features may allow for interactions with biological targets, potentially influencing enzyme activity or receptor binding. Additionally, the compound may exhibit various biological activities, including anti-inflammatory or antimicrobial properties, although specific biological data would depend on empirical studies. Overall, 1H-Pyrazolo[4,3-b]pyridine-5-carboxylic acid represents a versatile scaffold for further chemical modifications and applications in pharmaceutical research.
Formula:C7H5N3O2
InChI:InChI=1S/C7H5N3O2/c11-7(12)5-2-1-4-6(9-5)3-8-10-4/h1-3H,(H,8,10)(H,11,12)
InChI key:MFPLNQVEJKPCCB-UHFFFAOYSA-N
SMILES:C1=CC(=NC2=C1NN=C2)C(=O)O
Found 4 products.