CymitQuimica logo

CAS 1260671-35-9

:

1H-Pyrrolo[3,2-b]pyridine, 5-broMo-2,3-dihydro-

Description:
1H-Pyrrolo[3,2-b]pyridine, 5-bromo-2,3-dihydro- is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings. The presence of a bromine atom at the 5-position contributes to its reactivity and potential applications in medicinal chemistry and material science. This compound typically exhibits a range of physical properties, including a specific melting point and solubility characteristics that depend on the solvent used. Its molecular structure allows for various functionalization possibilities, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, the dihydro form indicates that it has two hydrogen atoms added to the ring system, which can influence its electronic properties and stability. The compound's unique structure and substituents may also impart specific biological activities, making it of interest in drug discovery and development. As with many brominated compounds, it is essential to handle it with care due to potential toxicity and environmental considerations.
Formula:C7H7BrN2
InChI:InChI=1S/C7H7BrN2/c8-7-2-1-5-6(10-7)3-4-9-5/h1-2,9H,3-4H2
InChI key:RJKVOWZLMOHIRM-UHFFFAOYSA-N
SMILES:C1CNC2=C1N=C(C=C2)Br
Synonyms:
  • 5-bromo-2,3-dihydro-1H-pyrrolo[3,2-b]pyridine
  • 1H-Pyrrolo[3,2-b]pyridine, 5-broMo-2,3-dihydro-
Found 5 products.