CymitQuimica logo

CAS 1260751-65-2

:

Ethyl2-cyano-5-fluorobenzoate

Description:
Ethyl 2-cyano-5-fluorobenzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid. It features a cyano group (-CN) and a fluorine atom attached to the aromatic ring, specifically at the 2 and 5 positions, respectively. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its moderate polarity due to the presence of the cyano and ester groups, which can influence its solubility in various organic solvents. Ethyl 2-cyano-5-fluorobenzoate may exhibit biological activity, making it of interest in pharmaceutical research and development. Its reactivity can be attributed to the electron-withdrawing nature of the cyano and fluorine substituents, which can enhance its electrophilic character in chemical reactions. Safety data should be consulted for handling, as it may pose health risks if inhaled or ingested. Overall, this compound serves as a valuable intermediate in organic synthesis and medicinal chemistry.
Formula:C10H8FNO2
InChI:InChI=1S/C10H8FNO2/c1-2-14-10(13)9-5-8(11)4-3-7(9)6-12/h3-5H,2H2,1H3
InChI key:QMZSRWKQXUGYBE-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=C(C=CC(=C1)F)C#N
Found 4 products.