CymitQuimica logo

CAS 1260843-59-1

:

3,4-Dibromo-5-fluoropyridine

Description:
3,4-Dibromo-5-fluoropyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with two bromine atoms and one fluorine atom. The presence of these halogen substituents significantly influences its chemical properties, including reactivity and polarity. This compound typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents such as dichloromethane and acetone, but may have limited solubility in water due to its hydrophobic nature. The bromine atoms can participate in various chemical reactions, such as nucleophilic substitutions, while the fluorine atom can enhance the compound's electrophilicity. 3,4-Dibromo-5-fluoropyridine is of interest in medicinal chemistry and materials science, often serving as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Its unique structure allows for potential applications in the development of biologically active compounds. Safety precautions should be taken when handling this substance, as halogenated compounds can pose health risks and environmental concerns.
Formula:C5H2Br2FN
InChI:InChI=1S/C5H2Br2FN/c6-3-1-9-2-4(8)5(3)7/h1-2H
InChI key:KJVNORXSGJINCX-UHFFFAOYSA-N
SMILES:C1=C(C(=C(C=N1)Br)Br)F
Found 4 products.